C26H29NO2 — CID 52951980
(3S,6S)-6-benzhydryl-N-[(4-methoxyphenyl)methyl]oxan-3-amine (PubChem CID 52951980) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is (3S,6S)-6-benzhydryl-N-[(4-methoxyphenyl)methyl]oxan-3-amine.
| Compound Name | (3S,6S)-6-benzhydryl-N-[(4-methoxyphenyl)methyl]oxan-3-amine |
|---|---|
| PubChem CID | 52951980 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (3S,6S)-6-benzhydryl-N-[(4-methoxyphenyl)methyl]oxan-3-amine |
| SMILES | COc1ccc(CN[C@H]2CC[C@@H](C(c3ccccc3)c3ccccc3)OC2)cc1 |
| InChI | InChI=1S/C26H29NO2/c1-28-24-15-12-20(13-16-24)18-27-23-14-17-25(29-19-23)26(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-13,15-16,23,25-27H,14,17-19H2,1H3/t23-,25-/m0/s1 |
| InChIKey | IVJJWTNIJPGFIV-ZCYQVOJMSA-N |
| XLogP | 5.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |