C26H26FNO2 — CID 69177779
N-[(6S)-6-benzhydryloxan-3-yl]-2-(4-fluorophenyl)acetamide (PubChem CID 69177779) has the molecular formula C26H26FNO2 and a molecular weight of 403.50 g/mol. Its IUPAC name is N-[(6S)-6-benzhydryloxan-3-yl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[(6S)-6-benzhydryloxan-3-yl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 69177779 |
| Molecular Formula | C26H26FNO2 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[(6S)-6-benzhydryloxan-3-yl]-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)NC1CC[C@@H](C(c2ccccc2)c2ccccc2)OC1 |
| InChI | InChI=1S/C26H26FNO2/c27-22-13-11-19(12-14-22)17-25(29)28-23-15-16-24(30-18-23)26(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-14,23-24,26H,15-18H2,(H,28,29)/t23?,24-/m0/s1 |
| InChIKey | SAOLEJAWCBSTCJ-CGAIIQECSA-N |
| XLogP | 4.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |