C17H16FNOS — CID 726142
N-cyclopropyl-2-[(4-fluorophenyl)methylsulfanyl]benzamide (PubChem CID 726142) has the molecular formula C17H16FNOS and a molecular weight of 301.39 g/mol. Its IUPAC name is N-cyclopropyl-2-[(4-fluorophenyl)methylsulfanyl]benzamide.
| Compound Name | N-cyclopropyl-2-[(4-fluorophenyl)methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 726142 |
| Molecular Formula | C17H16FNOS |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-cyclopropyl-2-[(4-fluorophenyl)methylsulfanyl]benzamide |
| SMILES | O=C(NC1CC1)c1ccccc1SCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FNOS/c18-13-7-5-12(6-8-13)11-21-16-4-2-1-3-15(16)17(20)19-14-9-10-14/h1-8,14H,9-11H2,(H,19,20) |
| InChIKey | GEMDDQCXJPAZSH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |