C22H32N2O2S — CID 9214809
2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-cyclopentylbenzamide (PubChem CID 9214809) has the molecular formula C22H32N2O2S and a molecular weight of 388.58 g/mol. Its IUPAC name is 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-cyclopentylbenzamide.
| Compound Name | 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-cyclopentylbenzamide |
|---|---|
| PubChem CID | 9214809 |
| Molecular Formula | C22H32N2O2S |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-cyclopentylbenzamide |
| SMILES | O=C(CSc1ccccc1C(=O)NC1CCCC1)NC1CCCCCCC1 |
| InChI | InChI=1S/C22H32N2O2S/c25-21(23-17-10-4-2-1-3-5-11-17)16-27-20-15-9-8-14-19(20)22(26)24-18-12-6-7-13-18/h8-9,14-15,17-18H,1-7,10-13,16H2,(H,23,25)(H,24,26) |
| InChIKey | YPTGQTCFDMXOSX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |