C24H29FN2O2S — CID 4856609
2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-[(2-fluorophenyl)methyl]benzamide (PubChem CID 4856609) has the molecular formula C24H29FN2O2S and a molecular weight of 428.57 g/mol. Its IUPAC name is 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-[(2-fluorophenyl)methyl]benzamide.
| Compound Name | 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-[(2-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 4856609 |
| Molecular Formula | C24H29FN2O2S |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-[(2-fluorophenyl)methyl]benzamide |
| SMILES | O=C(CSc1ccccc1C(=O)NCc1ccccc1F)NC1CCCCCCC1 |
| InChI | InChI=1S/C24H29FN2O2S/c25-21-14-8-6-10-18(21)16-26-24(29)20-13-7-9-15-22(20)30-17-23(28)27-19-11-4-2-1-3-5-12-19/h6-10,13-15,19H,1-5,11-12,16-17H2,(H,26,29)(H,27,28) |
| InChIKey | KPAKEMDFSSUFKQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |