C14H18N2O2S — CID 37345038
2-(2-amino-2-oxoethyl)sulfanyl-N-cyclopentylbenzamide (PubChem CID 37345038) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethyl)sulfanyl-N-cyclopentylbenzamide.
| Compound Name | 2-(2-amino-2-oxoethyl)sulfanyl-N-cyclopentylbenzamide |
|---|---|
| PubChem CID | 37345038 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-(2-amino-2-oxoethyl)sulfanyl-N-cyclopentylbenzamide |
| SMILES | NC(=O)CSc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C14H18N2O2S/c15-13(17)9-19-12-8-4-3-7-11(12)14(18)16-10-5-1-2-6-10/h3-4,7-8,10H,1-2,5-6,9H2,(H2,15,17)(H,16,18) |
| InChIKey | UZSHCKAQUIFJNC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |