C17H26ClN3O2S — CID 119589063
N-(2-amino-1-cyclohexylethyl)-2-(2-amino-2-oxoethyl)sulfanylbenzamide;hydrochloride (PubChem CID 119589063) has the molecular formula C17H26ClN3O2S and a molecular weight of 371.93 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2-(2-amino-2-oxoethyl)sulfanylbenzamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2-(2-amino-2-oxoethyl)sulfanylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119589063 |
| Molecular Formula | C17H26ClN3O2S |
| Molecular Weight | 371.93 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2-(2-amino-2-oxoethyl)sulfanylbenzamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)c1ccccc1SCC(N)=O)C1CCCCC1 |
| InChI | InChI=1S/C17H25N3O2S.ClH/c18-10-14(12-6-2-1-3-7-12)20-17(22)13-8-4-5-9-15(13)23-11-16(19)21;/h4-5,8-9,12,14H,1-3,6-7,10-11,18H2,(H2,19,21)(H,20,22);1H |
| InChIKey | NJFHZUIMJBUTLE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.93 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |