C21H31N3O2S — CID 119388889
2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanyl-N-piperidin-4-ylbenzamide (PubChem CID 119388889) has the molecular formula C21H31N3O2S and a molecular weight of 389.57 g/mol. Its IUPAC name is 2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanyl-N-piperidin-4-ylbenzamide.
| Compound Name | 2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanyl-N-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 119388889 |
| Molecular Formula | C21H31N3O2S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanyl-N-piperidin-4-ylbenzamide |
| SMILES | CN(C(=O)CSc1ccccc1C(=O)NC1CCNCC1)C1CCCCC1 |
| InChI | InChI=1S/C21H31N3O2S/c1-24(17-7-3-2-4-8-17)20(25)15-27-19-10-6-5-9-18(19)21(26)23-16-11-13-22-14-12-16/h5-6,9-10,16-17,22H,2-4,7-8,11-15H2,1H3,(H,23,26) |
| InChIKey | PCLZDHUTXKDSEG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |