C20H26N4O2S — CID 51237876
2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanyl-N-(1-methylpyrazol-3-yl)benzamide (PubChem CID 51237876) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is 2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanyl-N-(1-methylpyrazol-3-yl)benzamide.
| Compound Name | 2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanyl-N-(1-methylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 51237876 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanyl-N-(1-methylpyrazol-3-yl)benzamide |
| SMILES | CN(C(=O)CSc1ccccc1C(=O)Nc1ccn(C)n1)C1CCCCC1 |
| InChI | InChI=1S/C20H26N4O2S/c1-23-13-12-18(22-23)21-20(26)16-10-6-7-11-17(16)27-14-19(25)24(2)15-8-4-3-5-9-15/h6-7,10-13,15H,3-5,8-9,14H2,1-2H3,(H,21,22,26) |
| InChIKey | SUQHGKVNRYHNFU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |