C25H30N2O4S — CID 3253986
ethyl 4-[[2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanylbenzoyl]amino]benzoate (PubChem CID 3253986) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is ethyl 4-[[2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanylbenzoyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanylbenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 3253986 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | ethyl 4-[[2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanylbenzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ccccc2SCC(=O)N(C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H30N2O4S/c1-3-31-25(30)18-13-15-19(16-14-18)26-24(29)21-11-7-8-12-22(21)32-17-23(28)27(2)20-9-5-4-6-10-20/h7-8,11-16,20H,3-6,9-10,17H2,1-2H3,(H,26,29) |
| InChIKey | LUCZJMNPIHNGCT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |