C19H26N2O4S — CID 119177043
3-[[2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanylbenzoyl]amino]propanoic acid (PubChem CID 119177043) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is 3-[[2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanylbenzoyl]amino]propanoic acid.
| Compound Name | 3-[[2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanylbenzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119177043 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 3-[[2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanylbenzoyl]amino]propanoic acid |
| SMILES | CN(C(=O)CSc1ccccc1C(=O)NCCC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C19H26N2O4S/c1-21(14-7-3-2-4-8-14)17(22)13-26-16-10-6-5-9-15(16)19(25)20-12-11-18(23)24/h5-6,9-10,14H,2-4,7-8,11-13H2,1H3,(H,20,25)(H,23,24) |
| InChIKey | DIBJSPXUXXVINQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |