C24H29FN2O2S — CID 31737743
2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanyl-N-[2-(3-fluorophenyl)ethyl]benzamide (PubChem CID 31737743) has the molecular formula C24H29FN2O2S and a molecular weight of 428.57 g/mol. Its IUPAC name is 2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanyl-N-[2-(3-fluorophenyl)ethyl]benzamide.
| Compound Name | 2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanyl-N-[2-(3-fluorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 31737743 |
| Molecular Formula | C24H29FN2O2S |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanyl-N-[2-(3-fluorophenyl)ethyl]benzamide |
| SMILES | CN(C(=O)CSc1ccccc1C(=O)NCCc1cccc(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C24H29FN2O2S/c1-27(20-10-3-2-4-11-20)23(28)17-30-22-13-6-5-12-21(22)24(29)26-15-14-18-8-7-9-19(25)16-18/h5-9,12-13,16,20H,2-4,10-11,14-15,17H2,1H3,(H,26,29) |
| InChIKey | PIQJULCWBHWOHZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |