C13H14N4O2S — CID 51248279
2-(2-amino-2-oxoethyl)sulfanyl-N-(1-methylpyrazol-3-yl)benzamide (PubChem CID 51248279) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethyl)sulfanyl-N-(1-methylpyrazol-3-yl)benzamide.
| Compound Name | 2-(2-amino-2-oxoethyl)sulfanyl-N-(1-methylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 51248279 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-(2-amino-2-oxoethyl)sulfanyl-N-(1-methylpyrazol-3-yl)benzamide |
| SMILES | Cn1ccc(NC(=O)c2ccccc2SCC(N)=O)n1 |
| InChI | InChI=1S/C13H14N4O2S/c1-17-7-6-12(16-17)15-13(19)9-4-2-3-5-10(9)20-8-11(14)18/h2-7H,8H2,1H3,(H2,14,18)(H,15,16,19) |
| InChIKey | LXWRVSPFHMMOHI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |