C18H16FN3O2 — CID 24627289
2-[(4-fluorophenyl)methoxy]-N-(1-methylpyrazol-3-yl)benzamide (PubChem CID 24627289) has the molecular formula C18H16FN3O2 and a molecular weight of 325.34 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methoxy]-N-(1-methylpyrazol-3-yl)benzamide.
| Compound Name | 2-[(4-fluorophenyl)methoxy]-N-(1-methylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 24627289 |
| Molecular Formula | C18H16FN3O2 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-[(4-fluorophenyl)methoxy]-N-(1-methylpyrazol-3-yl)benzamide |
| SMILES | Cn1ccc(NC(=O)c2ccccc2OCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H16FN3O2/c1-22-11-10-17(21-22)20-18(23)15-4-2-3-5-16(15)24-12-13-6-8-14(19)9-7-13/h2-11H,12H2,1H3,(H,20,21,23) |
| InChIKey | UFWRFHXSZKUFKM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |