C25H21ClFN3O2 — CID 45355242
N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-2-[(4-fluorophenyl)methoxy]benzamide (PubChem CID 45355242) has the molecular formula C25H21ClFN3O2 and a molecular weight of 449.91 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-2-[(4-fluorophenyl)methoxy]benzamide.
| Compound Name | N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-2-[(4-fluorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 45355242 |
| Molecular Formula | C25H21ClFN3O2 |
| Molecular Weight | 449.91 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-2-[(4-fluorophenyl)methoxy]benzamide |
| SMILES | Cn1ccnc1C(NC(=O)c1ccccc1OCc1ccc(F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H21ClFN3O2/c1-30-15-14-28-24(30)23(18-8-10-19(26)11-9-18)29-25(31)21-4-2-3-5-22(21)32-16-17-6-12-20(27)13-7-17/h2-15,23H,16H2,1H3,(H,29,31) |
| InChIKey | NILMCKLMEKTDHK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.91 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |