C18H15F2N3O2 — CID 4774851
2-[(2,4-difluorophenoxy)methyl]-N-(1-methylpyrazol-3-yl)benzamide (PubChem CID 4774851) has the molecular formula C18H15F2N3O2 and a molecular weight of 343.33 g/mol. Its IUPAC name is 2-[(2,4-difluorophenoxy)methyl]-N-(1-methylpyrazol-3-yl)benzamide.
| Compound Name | 2-[(2,4-difluorophenoxy)methyl]-N-(1-methylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 4774851 |
| Molecular Formula | C18H15F2N3O2 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[(2,4-difluorophenoxy)methyl]-N-(1-methylpyrazol-3-yl)benzamide |
| SMILES | Cn1ccc(NC(=O)c2ccccc2COc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C18H15F2N3O2/c1-23-9-8-17(22-23)21-18(24)14-5-3-2-4-12(14)11-25-16-7-6-13(19)10-15(16)20/h2-10H,11H2,1H3,(H,21,22,24) |
| InChIKey | ZZQDYXHLTOYTLM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |