C24H34N4O2S — CID 86846279
2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-(2-methyl-3-pyrazol-1-ylpropyl)benzamide (PubChem CID 86846279) has the molecular formula C24H34N4O2S and a molecular weight of 442.63 g/mol. Its IUPAC name is 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-(2-methyl-3-pyrazol-1-ylpropyl)benzamide.
| Compound Name | 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-(2-methyl-3-pyrazol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 86846279 |
| Molecular Formula | C24H34N4O2S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-(2-methyl-3-pyrazol-1-ylpropyl)benzamide |
| SMILES | CC(CNC(=O)c1ccccc1SCC(=O)NC1CCCCCCC1)Cn1cccn1 |
| InChI | InChI=1S/C24H34N4O2S/c1-19(17-28-15-9-14-26-28)16-25-24(30)21-12-7-8-13-22(21)31-18-23(29)27-20-10-5-3-2-4-6-11-20/h7-9,12-15,19-20H,2-6,10-11,16-18H2,1H3,(H,25,30)(H,27,29) |
| InChIKey | BIMRIAQLAODCLH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |