C24H31N3O4S2 — CID 4791296
2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-[4-(methylsulfamoyl)phenyl]benzamide (PubChem CID 4791296) has the molecular formula C24H31N3O4S2 and a molecular weight of 489.66 g/mol. Its IUPAC name is 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-[4-(methylsulfamoyl)phenyl]benzamide.
| Compound Name | 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-[4-(methylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 4791296 |
| Molecular Formula | C24H31N3O4S2 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-[4-(methylsulfamoyl)phenyl]benzamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)c2ccccc2SCC(=O)NC2CCCCCCC2)cc1 |
| InChI | InChI=1S/C24H31N3O4S2/c1-25-33(30,31)20-15-13-19(14-16-20)27-24(29)21-11-7-8-12-22(21)32-17-23(28)26-18-9-5-3-2-4-6-10-18/h7-8,11-16,18,25H,2-6,9-10,17H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | ILUJLKKHZQJYLD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |