C18H16F2N2O2S — CID 9046628
N-cyclopropyl-2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]benzamide (PubChem CID 9046628) has the molecular formula C18H16F2N2O2S and a molecular weight of 362.40 g/mol. Its IUPAC name is N-cyclopropyl-2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]benzamide.
| Compound Name | N-cyclopropyl-2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 9046628 |
| Molecular Formula | C18H16F2N2O2S |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-cyclopropyl-2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]benzamide |
| SMILES | O=C(CSc1ccc(F)cc1F)Nc1ccccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C18H16F2N2O2S/c19-11-5-8-16(14(20)9-11)25-10-17(23)22-15-4-2-1-3-13(15)18(24)21-12-6-7-12/h1-5,8-9,12H,6-7,10H2,(H,21,24)(H,22,23) |
| InChIKey | FGLFNIXLSSEDHO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |