C27H29F2NO4 — CID 86304362
2-[bis(4-fluorophenyl)methyl]-5-[(2,5-dimethoxyphenyl)methylamino]oxan-4-ol (PubChem CID 86304362) has the molecular formula C27H29F2NO4 and a molecular weight of 469.53 g/mol. Its IUPAC name is 2-[bis(4-fluorophenyl)methyl]-5-[(2,5-dimethoxyphenyl)methylamino]oxan-4-ol.
| Compound Name | 2-[bis(4-fluorophenyl)methyl]-5-[(2,5-dimethoxyphenyl)methylamino]oxan-4-ol |
|---|---|
| PubChem CID | 86304362 |
| Molecular Formula | C27H29F2NO4 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 2-[bis(4-fluorophenyl)methyl]-5-[(2,5-dimethoxyphenyl)methylamino]oxan-4-ol |
| SMILES | COc1ccc(OC)c(CNC2COC(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2O)c1 |
| InChI | InChI=1S/C27H29F2NO4/c1-32-22-11-12-25(33-2)19(13-22)15-30-23-16-34-26(14-24(23)31)27(17-3-7-20(28)8-4-17)18-5-9-21(29)10-6-18/h3-13,23-24,26-27,30-31H,14-16H2,1-2H3 |
| InChIKey | POVRURSELNTFIN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |