C18H21NO2 — CID 58035512
(1S)-N-[(2,5-dimethoxyphenyl)methyl]-2-phenylcyclopropan-1-amine (PubChem CID 58035512) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (1S)-N-[(2,5-dimethoxyphenyl)methyl]-2-phenylcyclopropan-1-amine.
| Compound Name | (1S)-N-[(2,5-dimethoxyphenyl)methyl]-2-phenylcyclopropan-1-amine |
|---|---|
| PubChem CID | 58035512 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (1S)-N-[(2,5-dimethoxyphenyl)methyl]-2-phenylcyclopropan-1-amine |
| SMILES | COc1ccc(OC)c(CN[C@H]2CC2c2ccccc2)c1 |
| InChI | InChI=1S/C18H21NO2/c1-20-15-8-9-18(21-2)14(10-15)12-19-17-11-16(17)13-6-4-3-5-7-13/h3-10,16-17,19H,11-12H2,1-2H3/t16?,17-/m0/s1 |
| InChIKey | OUQLJDFSGAPTQF-DJNXLDHESA-N |
| XLogP | 3.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |