C19H21FO4 — CID 60541598
(2,5-dimethoxyphenyl)methyl 3-(4-fluorophenyl)butanoate (PubChem CID 60541598) has the molecular formula C19H21FO4 and a molecular weight of 332.37 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl 3-(4-fluorophenyl)butanoate.
| Compound Name | (2,5-dimethoxyphenyl)methyl 3-(4-fluorophenyl)butanoate |
|---|---|
| PubChem CID | 60541598 |
| Molecular Formula | C19H21FO4 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyl 3-(4-fluorophenyl)butanoate |
| SMILES | COc1ccc(OC)c(COC(=O)CC(C)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H21FO4/c1-13(14-4-6-16(20)7-5-14)10-19(21)24-12-15-11-17(22-2)8-9-18(15)23-3/h4-9,11,13H,10,12H2,1-3H3 |
| InChIKey | IQIHRALBNVIUMM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |