C17H19NO5 — CID 86979532
(2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate (PubChem CID 86979532) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate.
| Compound Name | (2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate |
|---|---|
| PubChem CID | 86979532 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate |
| SMILES | COc1ccc(OC)c(COC(=O)CCn2ccccc2=O)c1 |
| InChI | InChI=1S/C17H19NO5/c1-21-14-6-7-15(22-2)13(11-14)12-23-17(20)8-10-18-9-4-3-5-16(18)19/h3-7,9,11H,8,10,12H2,1-2H3 |
| InChIKey | NZKAXINVCAPFAW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |