(2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate

C17H19NO5 — CID 86979532

IUPAC(2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate
SMILESCOc1ccc(OC)c(COC(=O)CCn2ccccc2=O)c1
InChIInChI=1S/C17H19NO5/c1-21-14-6-7-15(22-2)13(11-14)12-23-17(20)8-10-18-9-4-3-5-16(18)19/h3-7,9,11H,8,10,12H2,1-2H3
InChIKeyNZKAXINVCAPFAW-UHFFFAOYSA-N
MW317.34 g/mol
LogP2.00
Rot. Bonds7

About (2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate

(2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate (PubChem CID 86979532) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate.

Molecular Properties

Compound Name(2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate
PubChem CID86979532
Molecular FormulaC17H19NO5
Molecular Weight317.34 g/mol
Exact Mass317.13
IUPAC Name(2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate
SMILESCOc1ccc(OC)c(COC(=O)CCn2ccccc2=O)c1
InChIInChI=1S/C17H19NO5/c1-21-14-6-7-15(22-2)13(11-14)12-23-17(20)8-10-18-9-4-3-5-16(18)19/h3-7,9,11H,8,10,12H2,1-2H3
InChIKeyNZKAXINVCAPFAW-UHFFFAOYSA-N
XLogP2.00
TPSA66.76 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.34
LogP ≤ 52.00
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze (2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate?
The IUPAC name of (2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate (CID 86979532) is (2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate.
What is the SMILES notation for (2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate?
The canonical SMILES for (2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate is COc1ccc(OC)c(COC(=O)CCn2ccccc2=O)c1.
What is the InChIKey of (2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate?
The InChIKey is NZKAXINVCAPFAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO5/c1-21-14-6-7-15(22-2)13(11-14)12-23-17(20)8-10-18-9-4-3-5-16(18)19/h3-7,9,11H,8,10,12H2,1-2H3.
What are the key properties of (2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate?
(2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate has a molecular weight of 317.34 g/mol, XLogP of 2.00, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethoxyphenyl)methyl 3-(2-oxo-1-pyridinyl)propanoate is sourced from PubChem (CID 86979532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).