C11H14FNO3 — CID 94260078
(5-fluoro-2-methoxyphenyl)methyl 3-aminopropanoate (PubChem CID 94260078) has the molecular formula C11H14FNO3 and a molecular weight of 227.23 g/mol. Its IUPAC name is (5-fluoro-2-methoxyphenyl)methyl 3-aminopropanoate.
| Compound Name | (5-fluoro-2-methoxyphenyl)methyl 3-aminopropanoate |
|---|---|
| PubChem CID | 94260078 |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | (5-fluoro-2-methoxyphenyl)methyl 3-aminopropanoate |
| SMILES | COc1ccc(F)cc1COC(=O)CCN |
| InChI | InChI=1S/C11H14FNO3/c1-15-10-3-2-9(12)6-8(10)7-16-11(14)4-5-13/h2-3,6H,4-5,7,13H2,1H3 |
| InChIKey | HVZBNHIPVCERHK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |