C11H14FNO3S2 — CID 88848186
(5-fluoro-2-methoxyphenyl)methyl N,N-bis(sulfanylmethyl)carbamate (PubChem CID 88848186) has the molecular formula C11H14FNO3S2 and a molecular weight of 291.37 g/mol. Its IUPAC name is (5-fluoro-2-methoxyphenyl)methyl N,N-bis(sulfanylmethyl)carbamate.
| Compound Name | (5-fluoro-2-methoxyphenyl)methyl N,N-bis(sulfanylmethyl)carbamate |
|---|---|
| PubChem CID | 88848186 |
| Molecular Formula | C11H14FNO3S2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | (5-fluoro-2-methoxyphenyl)methyl N,N-bis(sulfanylmethyl)carbamate |
| SMILES | COc1ccc(F)cc1COC(=O)N(CS)CS |
| InChI | InChI=1S/C11H14FNO3S2/c1-15-10-3-2-9(12)4-8(10)5-16-11(14)13(6-17)7-18/h2-4,17-18H,5-7H2,1H3 |
| InChIKey | QSHJPAQJSWJDIW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|