About bis[(5-fluoro-2-methoxyphenyl)methyl] (E)-but-2-enedioate
bis[(5-fluoro-2-methoxyphenyl)methyl] (E)-but-2-enedioate (PubChem CID 9010730) has the molecular formula C20H18F2O6
and a molecular weight of 392.35 g/mol. Its IUPAC name is bis[(5-fluoro-2-methoxyphenyl)methyl] (E)-but-2-enedioate.
Molecular Properties
| Compound Name | bis[(5-fluoro-2-methoxyphenyl)methyl] (E)-but-2-enedioate |
| PubChem CID | 9010730 |
| Molecular Formula | C20H18F2O6 |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | bis[(5-fluoro-2-methoxyphenyl)methyl] (E)-but-2-enedioate |
| SMILES | COc1ccc(F)cc1COC(=O)/C=C/C(=O)OCc1cc(F)ccc1OC |
| InChI | InChI=1S/C20H18F2O6/c1-25-17-5-3-15(21)9-13(17)11-27-19(23)7-8-20(24)28-12-14-10-16(22)4-6-18(14)26-2/h3-10H,11-12H2,1-2H3/b8-7+ |
| InChIKey | DCRBWPFRSFWXFF-BQYQJAHWSA-N |
| XLogP | 3.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis[(5-fluoro-2-methoxyphenyl)methyl] (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(5-fluoro-2-methoxyphenyl)methyl] (E)-but-2-enedioate?
The IUPAC name of bis[(5-fluoro-2-methoxyphenyl)methyl] (E)-but-2-enedioate (CID 9010730) is bis[(5-fluoro-2-methoxyphenyl)methyl] (E)-but-2-enedioate.
What is the SMILES notation for bis[(5-fluoro-2-methoxyphenyl)methyl] (E)-but-2-enedioate?
The canonical SMILES for bis[(5-fluoro-2-methoxyphenyl)methyl] (E)-but-2-enedioate is COc1ccc(F)cc1COC(=O)/C=C/C(=O)OCc1cc(F)ccc1OC.
What is the InChIKey of bis[(5-fluoro-2-methoxyphenyl)methyl] (E)-but-2-enedioate?
The InChIKey is DCRBWPFRSFWXFF-BQYQJAHWSA-N. The full InChI is InChI=1S/C20H18F2O6/c1-25-17-5-3-15(21)9-13(17)11-27-19(23)7-8-20(24)28-12-14-10-16(22)4-6-18(14)26-2/h3-10H,11-12H2,1-2H3/b8-7+.
What are the key properties of bis[(5-fluoro-2-methoxyphenyl)methyl] (E)-but-2-enedioate?
bis[(5-fluoro-2-methoxyphenyl)methyl] (E)-but-2-enedioate has a molecular weight of 392.35 g/mol, XLogP of 3.32, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(5-fluoro-2-methoxyphenyl)methyl] (E)-but-2-enedioate is sourced from PubChem (CID 9010730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).