C16H15ClO4 — CID 60606971
(2,5-dimethoxyphenyl)methyl 2-chlorobenzoate (PubChem CID 60606971) has the molecular formula C16H15ClO4 and a molecular weight of 306.75 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl 2-chlorobenzoate.
| Compound Name | (2,5-dimethoxyphenyl)methyl 2-chlorobenzoate |
|---|---|
| PubChem CID | 60606971 |
| Molecular Formula | C16H15ClO4 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyl 2-chlorobenzoate |
| SMILES | COc1ccc(OC)c(COC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C16H15ClO4/c1-19-12-7-8-15(20-2)11(9-12)10-21-16(18)13-5-3-4-6-14(13)17/h3-9H,10H2,1-2H3 |
| InChIKey | VBQSDRIPVTUTIC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |