C20H21NO5 — CID 9134704
(2,5-dimethoxyphenyl)methyl 2-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 9134704) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl 2-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | (2,5-dimethoxyphenyl)methyl 2-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 9134704 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyl 2-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | COc1ccc(OC)c(COC(=O)c2ccccc2N2CCCC2=O)c1 |
| InChI | InChI=1S/C20H21NO5/c1-24-15-9-10-18(25-2)14(12-15)13-26-20(23)16-6-3-4-7-17(16)21-11-5-8-19(21)22/h3-4,6-7,9-10,12H,5,8,11,13H2,1-2H3 |
| InChIKey | IRKFSSUJWVIIGO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |