C19H19NO3 — CID 9133484
(3-methylphenyl)methyl 2-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 9133484) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is (3-methylphenyl)methyl 2-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | (3-methylphenyl)methyl 2-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 9133484 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (3-methylphenyl)methyl 2-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | Cc1cccc(COC(=O)c2ccccc2N2CCCC2=O)c1 |
| InChI | InChI=1S/C19H19NO3/c1-14-6-4-7-15(12-14)13-23-19(22)16-8-2-3-9-17(16)20-11-5-10-18(20)21/h2-4,6-9,12H,5,10-11,13H2,1H3 |
| InChIKey | OHCXCHMAGJPGJQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |