C14H22N2O5S — CID 162789736
N-[[3-hydroxy-4-[(4-methoxyphenyl)methylamino]oxolan-2-yl]methyl]methanesulfonamide (PubChem CID 162789736) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is N-[[3-hydroxy-4-[(4-methoxyphenyl)methylamino]oxolan-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[[3-hydroxy-4-[(4-methoxyphenyl)methylamino]oxolan-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 162789736 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[[3-hydroxy-4-[(4-methoxyphenyl)methylamino]oxolan-2-yl]methyl]methanesulfonamide |
| SMILES | COc1ccc(CNC2COC(CNS(C)(=O)=O)C2O)cc1 |
| InChI | InChI=1S/C14H22N2O5S/c1-20-11-5-3-10(4-6-11)7-15-12-9-21-13(14(12)17)8-16-22(2,18)19/h3-6,12-17H,7-9H2,1-2H3 |
| InChIKey | CTKMXOJSJWMBQC-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |