C22H30N2O2 — CID 11314223
trans-(1R,2R)-1-N,2-N-bis[(4-methoxyphenyl)methyl]cyclohexane-1,2-diamine (PubChem CID 11314223) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is trans-(1R,2R)-1-N,2-N-bis[(4-methoxyphenyl)methyl]cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N,2-N-bis[(4-methoxyphenyl)methyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 11314223 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | trans-(1R,2R)-1-N,2-N-bis[(4-methoxyphenyl)methyl]cyclohexane-1,2-diamine |
| SMILES | COc1ccc(CN[C@@H]2CCCC[C@H]2NCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H30N2O2/c1-25-19-11-7-17(8-12-19)15-23-21-5-3-4-6-22(21)24-16-18-9-13-20(26-2)14-10-18/h7-14,21-24H,3-6,15-16H2,1-2H3/t21-,22-/m1/s1 |
| InChIKey | NYHUNUXCWYCUNU-FGZHOGPDSA-N |
| XLogP | 3.89 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |