C14H22N2O2 — CID 173186747
trans-(1R,2R)-2-[2-[(4-methoxyphenyl)methyl]hydrazinyl]cyclohexan-1-ol (PubChem CID 173186747) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is trans-(1R,2R)-2-[2-[(4-methoxyphenyl)methyl]hydrazinyl]cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-[2-[(4-methoxyphenyl)methyl]hydrazinyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 173186747 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | trans-(1R,2R)-2-[2-[(4-methoxyphenyl)methyl]hydrazinyl]cyclohexan-1-ol |
| SMILES | COc1ccc(CNN[C@@H]2CCCC[C@H]2O)cc1 |
| InChI | InChI=1S/C14H22N2O2/c1-18-12-8-6-11(7-9-12)10-15-16-13-4-2-3-5-14(13)17/h6-9,13-17H,2-5,10H2,1H3/t13-,14-/m1/s1 |
| InChIKey | VQCGKVIIPQFWCL-ZIAGYGMSSA-N |
| XLogP | 1.59 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|