C30H35NO6 — CID 102153212
tert-butyl (3S,4R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 102153212) has the molecular formula C30H35NO6 and a molecular weight of 505.61 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102153212 |
| Molecular Formula | C30H35NO6 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | tert-butyl (3S,4R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | COc1ccc(C(O[C@H]2CN(C(=O)OC(C)(C)C)C[C@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H35NO6/c1-29(2,3)37-28(33)31-19-26(32)27(20-31)36-30(21-9-7-6-8-10-21,22-11-15-24(34-4)16-12-22)23-13-17-25(35-5)18-14-23/h6-18,26-27,32H,19-20H2,1-5H3/t26-,27+/m1/s1 |
| InChIKey | CVBNBHLLSHTNKI-SXOMAYOGSA-N |
| XLogP | 4.99 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|