C27H28O6 — CID 176862335
(3R,3aR,6R,6aR)-6-[bis(4-methoxyphenyl)-phenylmethoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 176862335) has the molecular formula C27H28O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[bis(4-methoxyphenyl)-phenylmethoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[bis(4-methoxyphenyl)-phenylmethoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 176862335 |
| Molecular Formula | C27H28O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[bis(4-methoxyphenyl)-phenylmethoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | COc1ccc(C(O[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H28O6/c1-29-21-12-8-19(9-13-21)27(18-6-4-3-5-7-18,20-10-14-22(30-2)15-11-20)33-24-17-32-25-23(28)16-31-26(24)25/h3-15,23-26,28H,16-17H2,1-2H3/t23-,24-,25-,26-/m1/s1 |
| InChIKey | XZNOZCBVQKQLSZ-VEYUFSJPSA-N |
| XLogP | 3.54 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|