C25H26O4 — CID 177315684
(2S)-2-[1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]oxirane (PubChem CID 177315684) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is (2S)-2-[1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]oxirane.
| Compound Name | (2S)-2-[1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]oxirane |
|---|---|
| PubChem CID | 177315684 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (2S)-2-[1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]oxirane |
| SMILES | COc1ccc(C(OC(C)[C@@H]2CO2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H26O4/c1-18(24-17-28-24)29-25(19-7-5-4-6-8-19,20-9-13-22(26-2)14-10-20)21-11-15-23(27-3)16-12-21/h4-16,18,24H,17H2,1-3H3/t18?,24-/m0/s1 |
| InChIKey | VXONWDVJGVIJFF-LUTIACGYSA-N |
| XLogP | 4.80 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|