C24H24O3 — CID 10861318
(2S,3R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-methyloxirane (PubChem CID 10861318) has the molecular formula C24H24O3 and a molecular weight of 360.45 g/mol. Its IUPAC name is (2S,3R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-methyloxirane.
| Compound Name | (2S,3R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-methyloxirane |
|---|---|
| PubChem CID | 10861318 |
| Molecular Formula | C24H24O3 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (2S,3R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-methyloxirane |
| SMILES | COc1ccc(C(OC[C@@H]2O[C@@H]2C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24O3/c1-18-23(27-18)17-26-24(19-9-5-3-6-10-19,20-11-7-4-8-12-20)21-13-15-22(25-2)16-14-21/h3-16,18,23H,17H2,1-2H3/t18-,23+/m1/s1 |
| InChIKey | CRBIZKJTNDYHSY-JPYJTQIMSA-N |
| XLogP | 4.79 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|