C26H28O4 — CID 171805579
4-[(4-methoxyphenyl)-[(5-methyloxolan-2-yl)methoxy]-phenylmethyl]phenol (PubChem CID 171805579) has the molecular formula C26H28O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)-[(5-methyloxolan-2-yl)methoxy]-phenylmethyl]phenol.
| Compound Name | 4-[(4-methoxyphenyl)-[(5-methyloxolan-2-yl)methoxy]-phenylmethyl]phenol |
|---|---|
| PubChem CID | 171805579 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 4-[(4-methoxyphenyl)-[(5-methyloxolan-2-yl)methoxy]-phenylmethyl]phenol |
| SMILES | COc1ccc(C(OCC2CCC(C)O2)(c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C26H28O4/c1-19-8-15-25(30-19)18-29-26(20-6-4-3-5-7-20,21-9-13-23(27)14-10-21)22-11-16-24(28-2)17-12-22/h3-7,9-14,16-17,19,25,27H,8,15,18H2,1-2H3 |
| InChIKey | LWJFJTGDLSYQTR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|