C25H24O4 — CID 10786507
(5R)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-one (PubChem CID 10786507) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is (5R)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-one.
| Compound Name | (5R)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-one |
|---|---|
| PubChem CID | 10786507 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (5R)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-one |
| SMILES | COc1ccc(C(OC[C@H]2CCC(=O)O2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24O4/c1-27-22-14-12-21(13-15-22)25(19-8-4-2-5-9-19,20-10-6-3-7-11-20)28-18-23-16-17-24(26)29-23/h2-15,23H,16-18H2,1H3/t23-/m1/s1 |
| InChIKey | YVDYLYRTSVARJR-HSZRJFAPSA-N |
| XLogP | 4.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|