C23H21NO3 — CID 10109102
5-(trityloxymethyl)-1,3-oxazolidin-2-one (PubChem CID 10109102) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 5-(trityloxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(trityloxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10109102 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 5-(trityloxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1NCC(COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C23H21NO3/c25-22-24-16-21(27-22)17-26-23(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21H,16-17H2,(H,24,25) |
| InChIKey | NONOANCJDOAYFL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|