C30H26O4S — CID 11202502
(5S)-3-(benzenesulfinyl)-5-(trityloxymethyl)oxolan-2-one (PubChem CID 11202502) has the molecular formula C30H26O4S and a molecular weight of 482.60 g/mol. Its IUPAC name is (5S)-3-(benzenesulfinyl)-5-(trityloxymethyl)oxolan-2-one.
| Compound Name | (5S)-3-(benzenesulfinyl)-5-(trityloxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 11202502 |
| Molecular Formula | C30H26O4S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | (5S)-3-(benzenesulfinyl)-5-(trityloxymethyl)oxolan-2-one |
| SMILES | O=C1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)CC1S(=O)c1ccccc1 |
| InChI | InChI=1S/C30H26O4S/c31-29-28(35(32)27-19-11-4-12-20-27)21-26(34-29)22-33-30(23-13-5-1-6-14-23,24-15-7-2-8-16-24)25-17-9-3-10-18-25/h1-20,26,28H,21-22H2/t26-,28?,35?/m0/s1 |
| InChIKey | IPDPMDMVMLYKLF-HLNXFJMYSA-N |
| XLogP | 5.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|