C24H22O4 — CID 15478722
(3S,5S)-3-hydroxy-5-(trityloxymethyl)oxolan-2-one (PubChem CID 15478722) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is (3S,5S)-3-hydroxy-5-(trityloxymethyl)oxolan-2-one.
| Compound Name | (3S,5S)-3-hydroxy-5-(trityloxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 15478722 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (3S,5S)-3-hydroxy-5-(trityloxymethyl)oxolan-2-one |
| SMILES | O=C1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C24H22O4/c25-22-16-21(28-23(22)26)17-27-24(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21-22,25H,16-17H2/t21-,22-/m0/s1 |
| InChIKey | KJJWSIAUQRQBFL-VXKWHMMOSA-N |
| XLogP | 3.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|