C25H26O4 — CID 178184681
(2R,3R,5R)-2-methoxy-5-(trityloxymethyl)oxolan-3-ol (PubChem CID 178184681) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is (2R,3R,5R)-2-methoxy-5-(trityloxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,5R)-2-methoxy-5-(trityloxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 178184681 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (2R,3R,5R)-2-methoxy-5-(trityloxymethyl)oxolan-3-ol |
| SMILES | CO[C@@H]1O[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C25H26O4/c1-27-24-23(26)17-22(29-24)18-28-25(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,22-24,26H,17-18H2,1H3/t22-,23-,24-/m1/s1 |
| InChIKey | WHUGCYKXUNXMIL-WXFUMESZSA-N |
| XLogP | 4.12 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|