C28H32O3 — CID 134878021
(2S,3S,5R,6S)-2-methoxy-3,5-dimethyl-6-(trityloxymethyl)oxane (PubChem CID 134878021) has the molecular formula C28H32O3 and a molecular weight of 416.56 g/mol. Its IUPAC name is (2S,3S,5R,6S)-2-methoxy-3,5-dimethyl-6-(trityloxymethyl)oxane.
| Compound Name | (2S,3S,5R,6S)-2-methoxy-3,5-dimethyl-6-(trityloxymethyl)oxane |
|---|---|
| PubChem CID | 134878021 |
| Molecular Formula | C28H32O3 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (2S,3S,5R,6S)-2-methoxy-3,5-dimethyl-6-(trityloxymethyl)oxane |
| SMILES | CO[C@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C28H32O3/c1-21-19-22(2)27(29-3)31-26(21)20-30-28(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,21-22,26-27H,19-20H2,1-3H3/t21-,22+,26-,27+/m1/s1 |
| InChIKey | YUMDNKKGNAJGHF-IMIIGWPFSA-N |
| XLogP | 6.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|