C25H24O6S — CID 10766059
(3aR,4R,6R,6aR)-4-methoxy-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide (PubChem CID 10766059) has the molecular formula C25H24O6S and a molecular weight of 452.53 g/mol. Its IUPAC name is (3aR,4R,6R,6aR)-4-methoxy-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide.
| Compound Name | (3aR,4R,6R,6aR)-4-methoxy-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide |
|---|---|
| PubChem CID | 10766059 |
| Molecular Formula | C25H24O6S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | (3aR,4R,6R,6aR)-4-methoxy-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide |
| SMILES | CO[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]2OS(=O)O[C@@H]12 |
| InChI | InChI=1S/C25H24O6S/c1-27-24-23-22(30-32(26)31-23)21(29-24)17-28-25(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21-24H,17H2,1H3/t21-,22-,23-,24-,32?/m1/s1 |
| InChIKey | RFQREOQDTMKRJR-FJETXIILSA-N |
| XLogP | 3.73 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|