C27H30O7 — CID 10994273
(2S,3S,4S,5S,6R)-2-methoxy-6-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxane-3,4,5-triol (PubChem CID 10994273) has the molecular formula C27H30O7 and a molecular weight of 466.53 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-2-methoxy-6-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5S,6R)-2-methoxy-6-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10994273 |
| Molecular Formula | C27H30O7 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | (2S,3S,4S,5S,6R)-2-methoxy-6-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxane-3,4,5-triol |
| SMILES | COc1ccc(C(OC[C@H]2O[C@H](OC)[C@@H](O)[C@@H](O)[C@@H]2O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H30O7/c1-31-21-15-13-20(14-16-21)27(18-9-5-3-6-10-18,19-11-7-4-8-12-19)33-17-22-23(28)24(29)25(30)26(32-2)34-22/h3-16,22-26,28-30H,17H2,1-2H3/t22-,23-,24+,25+,26+/m1/s1 |
| InChIKey | MFDHKPAATBXOIE-JMTTVTNBSA-N |
| XLogP | 2.46 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|