C26H28O6S — CID 102353072
(2R,3S,4S,5R,6S)-2-[[diphenyl-(4-sulfanylphenyl)methoxy]methyl]-6-methoxyoxane-3,4,5-triol (PubChem CID 102353072) has the molecular formula C26H28O6S and a molecular weight of 468.57 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-[[diphenyl-(4-sulfanylphenyl)methoxy]methyl]-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-[[diphenyl-(4-sulfanylphenyl)methoxy]methyl]-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 102353072 |
| Molecular Formula | C26H28O6S |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-[[diphenyl-(4-sulfanylphenyl)methoxy]methyl]-6-methoxyoxane-3,4,5-triol |
| SMILES | CO[C@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccc(S)cc2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H28O6S/c1-30-25-24(29)23(28)22(27)21(32-25)16-31-26(17-8-4-2-5-9-17,18-10-6-3-7-11-18)19-12-14-20(33)15-13-19/h2-15,21-25,27-29,33H,16H2,1H3/t21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | ULAYSPKYLDDSBO-RXFVIIJJSA-N |
| XLogP | 2.74 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|