C34H44O5 — CID 153365555
(2R,3R,4S,5R)-2-decoxy-5-(trityloxymethyl)oxolane-3,4-diol (PubChem CID 153365555) has the molecular formula C34H44O5 and a molecular weight of 532.72 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-decoxy-5-(trityloxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-decoxy-5-(trityloxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 153365555 |
| Molecular Formula | C34H44O5 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | (2R,3R,4S,5R)-2-decoxy-5-(trityloxymethyl)oxolane-3,4-diol |
| SMILES | CCCCCCCCCCO[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C34H44O5/c1-2-3-4-5-6-7-8-18-25-37-33-32(36)31(35)30(39-33)26-38-34(27-19-12-9-13-20-27,28-21-14-10-15-22-28)29-23-16-11-17-24-29/h9-17,19-24,30-33,35-36H,2-8,18,25-26H2,1H3/t30-,31-,32-,33-/m1/s1 |
| InChIKey | JMMXQIDXFIBAAN-XEXPGFJZSA-N |
| XLogP | 6.60 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|