C36H48O9 — CID 164788382
2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(5-butoxypentoxy)oxane-3,4,5-triol (PubChem CID 164788382) has the molecular formula C36H48O9 and a molecular weight of 624.77 g/mol. Its IUPAC name is 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(5-butoxypentoxy)oxane-3,4,5-triol.
| Compound Name | 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(5-butoxypentoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 164788382 |
| Molecular Formula | C36H48O9 |
| Molecular Weight | 624.77 g/mol |
| Exact Mass | 624.33 |
| IUPAC Name | 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(5-butoxypentoxy)oxane-3,4,5-triol |
| SMILES | CCCCOCCCCCOC1OC(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)C(O)C(O)C1O |
| InChI | InChI=1S/C36H48O9/c1-4-5-22-42-23-10-7-11-24-43-35-34(39)33(38)32(37)31(45-35)25-44-36(26-12-8-6-9-13-26,27-14-18-29(40-2)19-15-27)28-16-20-30(41-3)21-17-28/h6,8-9,12-21,31-35,37-39H,4-5,7,10-11,22-25H2,1-3H3 |
| InChIKey | FHFTVFUQDXIIKK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.77 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|