C31H36O11 — CID 171126524
(2S,3R,4S,5S,6R)-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(trityloxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol (PubChem CID 171126524) has the molecular formula C31H36O11 and a molecular weight of 584.62 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(trityloxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5S,6R)-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(trityloxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 171126524 |
| Molecular Formula | C31H36O11 |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | (2S,3R,4S,5S,6R)-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(trityloxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](O)O[C@H](CO[C@H]2O[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H](O)[C@H](O)[C@H]2O)[C@H]1O |
| InChI | InChI=1S/C31H36O11/c32-23-21(41-29(38)27(36)25(23)34)16-39-30-28(37)26(35)24(33)22(42-30)17-40-31(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21-30,32-38H,16-17H2/t21-,22-,23-,24-,25+,26+,27-,28-,29+,30+/m1/s1 |
| InChIKey | JBGNYXOUKQCHHQ-IGIKRYNKSA-N |
| XLogP | -0.38 |
| TPSA | 178.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|