C25H25FO5 — CID 171123594
(2S,3S,4S,5R,6R)-5-fluoro-6-(trityloxymethyl)oxane-2,3,4-triol (PubChem CID 171123594) has the molecular formula C25H25FO5 and a molecular weight of 424.47 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-5-fluoro-6-(trityloxymethyl)oxane-2,3,4-triol.
| Compound Name | (2S,3S,4S,5R,6R)-5-fluoro-6-(trityloxymethyl)oxane-2,3,4-triol |
|---|---|
| PubChem CID | 171123594 |
| Molecular Formula | C25H25FO5 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (2S,3S,4S,5R,6R)-5-fluoro-6-(trityloxymethyl)oxane-2,3,4-triol |
| SMILES | O[C@H]1[C@H](O)[C@@H](O)O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H]1F |
| InChI | InChI=1S/C25H25FO5/c26-21-20(31-24(29)23(28)22(21)27)16-30-25(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20-24,27-29H,16H2/t20-,21+,22-,23+,24+/m1/s1 |
| InChIKey | QPICWOAAIGYZGT-KNOCVWDGSA-N |
| XLogP | 2.77 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|